About 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine
5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine (PubChem CID 65418555) has the molecular formula C6H12N4O3S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine.
Molecular Properties
| Compound Name | 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine |
| PubChem CID | 65418555 |
| Molecular Formula | C6H12N4O3S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine |
| SMILES | CS(=O)(=O)CCC(N)c1nc(N)no1 |
| InChI | InChI=1S/C6H12N4O3S/c1-14(11,12)3-2-4(7)5-9-6(8)10-13-5/h4H,2-3,7H2,1H3,(H2,8,10) |
| InChIKey | XGEGQOJSUBGTPD-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 125.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine?
The IUPAC name of 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine (CID 65418555) is 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine.
What is the SMILES notation for 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine?
The canonical SMILES for 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine is CS(=O)(=O)CCC(N)c1nc(N)no1.
What is the InChIKey of 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine?
The InChIKey is XGEGQOJSUBGTPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4O3S/c1-14(11,12)3-2-4(7)5-9-6(8)10-13-5/h4H,2-3,7H2,1H3,(H2,8,10).
What are the key properties of 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine?
5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine has a molecular weight of 220.25 g/mol, XLogP of -0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-amino-3-methylsulfonylpropyl)-1,2,4-oxadiazol-3-amine is sourced from PubChem (CID 65418555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).