C12H16N4O3 — CID 65418820
2-[1-(3,6-dimethylpyrazin-2-yl)-3-oxopiperazin-2-yl]acetic acid (PubChem CID 65418820) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 2-[1-(3,6-dimethylpyrazin-2-yl)-3-oxopiperazin-2-yl]acetic acid.
| Compound Name | 2-[1-(3,6-dimethylpyrazin-2-yl)-3-oxopiperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 65418820 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 2-[1-(3,6-dimethylpyrazin-2-yl)-3-oxopiperazin-2-yl]acetic acid |
| SMILES | Cc1cnc(C)c(N2CCNC(=O)C2CC(=O)O)n1 |
| InChI | InChI=1S/C12H16N4O3/c1-7-6-14-8(2)11(15-7)16-4-3-13-12(19)9(16)5-10(17)18/h6,9H,3-5H2,1-2H3,(H,13,19)(H,17,18) |
| InChIKey | JNUKOVUFRUJZCV-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |