C6H15N3O4S2 — CID 65420912
N-(2-sulfamoylethyl)pyrrolidine-3-sulfonamide (PubChem CID 65420912) has the molecular formula C6H15N3O4S2 and a molecular weight of 257.34 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)pyrrolidine-3-sulfonamide.
| Compound Name | N-(2-sulfamoylethyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 65420912 |
| Molecular Formula | C6H15N3O4S2 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-(2-sulfamoylethyl)pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)CCNS(=O)(=O)C1CCNC1 |
| InChI | InChI=1S/C6H15N3O4S2/c7-14(10,11)4-3-9-15(12,13)6-1-2-8-5-6/h6,8-9H,1-5H2,(H2,7,10,11) |
| InChIKey | PAMLTURLHFSYIY-UHFFFAOYSA-N |
| XLogP | -2.44 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |