C13H18FN — CID 65421935
N-[(2-fluorophenyl)-(2-methylcyclopropyl)methyl]ethanamine (PubChem CID 65421935) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is N-[(2-fluorophenyl)-(2-methylcyclopropyl)methyl]ethanamine.
| Compound Name | N-[(2-fluorophenyl)-(2-methylcyclopropyl)methyl]ethanamine |
|---|---|
| PubChem CID | 65421935 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-[(2-fluorophenyl)-(2-methylcyclopropyl)methyl]ethanamine |
| SMILES | CCNC(c1ccccc1F)C1CC1C |
| InChI | InChI=1S/C13H18FN/c1-3-15-13(11-8-9(11)2)10-6-4-5-7-12(10)14/h4-7,9,11,13,15H,3,8H2,1-2H3 |
| InChIKey | CSKAEWJFROHZAO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |