About (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine
(2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine (PubChem CID 65422351) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine.
Molecular Properties
| Compound Name | (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine |
| PubChem CID | 65422351 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)C2CC2C)cc1C |
| InChI | InChI=1S/C14H21N/c1-8-5-10(3)12(6-9(8)2)14(15)13-7-11(13)4/h5-6,11,13-14H,7,15H2,1-4H3 |
| InChIKey | HILKXVBYUBUJCJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine?
The IUPAC name of (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine (CID 65422351) is (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine.
What is the SMILES notation for (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine?
The canonical SMILES for (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine is Cc1cc(C)c(C(N)C2CC2C)cc1C.
What is the InChIKey of (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine?
The InChIKey is HILKXVBYUBUJCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-8-5-10(3)12(6-9(8)2)14(15)13-7-11(13)4/h5-6,11,13-14H,7,15H2,1-4H3.
What are the key properties of (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine?
(2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine has a molecular weight of 203.33 g/mol, XLogP of 3.27, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylcyclopropyl)-(2,4,5-trimethylphenyl)methanamine is sourced from PubChem (CID 65422351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).