C13H26N2O2 — CID 65422501
5,5-dimethyl-3-(4-methylpiperazin-1-yl)hexanoic acid (PubChem CID 65422501) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 5,5-dimethyl-3-(4-methylpiperazin-1-yl)hexanoic acid.
| Compound Name | 5,5-dimethyl-3-(4-methylpiperazin-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 65422501 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 5,5-dimethyl-3-(4-methylpiperazin-1-yl)hexanoic acid |
| SMILES | CN1CCN(C(CC(=O)O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-13(2,3)10-11(9-12(16)17)15-7-5-14(4)6-8-15/h11H,5-10H2,1-4H3,(H,16,17) |
| InChIKey | PJCFLDGPDWLISO-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |