C12H21N3S — CID 65423064
3-cycloheptyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 65423064) has the molecular formula C12H21N3S and a molecular weight of 239.39 g/mol. Its IUPAC name is 3-cycloheptyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-cycloheptyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 65423064 |
| Molecular Formula | C12H21N3S |
| Molecular Weight | 239.39 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-cycloheptyl-N-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)Nc1nc(C2CCCCCC2)ns1 |
| InChI | InChI=1S/C12H21N3S/c1-9(2)13-12-14-11(15-16-12)10-7-5-3-4-6-8-10/h9-10H,3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | NISOBGVJGLNATL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |