About 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone
2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone (PubChem CID 654244) has the molecular formula C15H20N4OS
and a molecular weight of 304.42 g/mol. Its IUPAC name is 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone |
| PubChem CID | 654244 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCN(C(=O)CSc2nc3cccnc3n2C)CC1 |
| InChI | InChI=1S/C15H20N4OS/c1-11-5-8-19(9-6-11)13(20)10-21-15-17-12-4-3-7-16-14(12)18(15)2/h3-4,7,11H,5-6,8-10H2,1-2H3 |
| InChIKey | OMSRIABMRGCWSB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone?
The IUPAC name of 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone (CID 654244) is 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone.
What is the SMILES notation for 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone?
The canonical SMILES for 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone is CC1CCN(C(=O)CSc2nc3cccnc3n2C)CC1.
What is the InChIKey of 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone?
The InChIKey is OMSRIABMRGCWSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4OS/c1-11-5-8-19(9-6-11)13(20)10-21-15-17-12-4-3-7-16-14(12)18(15)2/h3-4,7,11H,5-6,8-10H2,1-2H3.
What are the key properties of 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone?
2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone has a molecular weight of 304.42 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methylimidazo[4,5-b]pyridin-2-yl)sulfanyl-1-(4-methylpiperidin-1-yl)ethanone is sourced from PubChem (CID 654244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).