C17H21BrFN — CID 65424452
1-[(2-bromo-4-fluorophenyl)methyl]-4-propylcyclohexane-1-carbonitrile (PubChem CID 65424452) has the molecular formula C17H21BrFN and a molecular weight of 338.26 g/mol. Its IUPAC name is 1-[(2-bromo-4-fluorophenyl)methyl]-4-propylcyclohexane-1-carbonitrile.
| Compound Name | 1-[(2-bromo-4-fluorophenyl)methyl]-4-propylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 65424452 |
| Molecular Formula | C17H21BrFN |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 1-[(2-bromo-4-fluorophenyl)methyl]-4-propylcyclohexane-1-carbonitrile |
| SMILES | CCCC1CCC(C#N)(Cc2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C17H21BrFN/c1-2-3-13-6-8-17(12-20,9-7-13)11-14-4-5-15(19)10-16(14)18/h4-5,10,13H,2-3,6-9,11H2,1H3 |
| InChIKey | YSGZAKPYSCYGPQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |