3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid

C15H21N3O2 — CID 65427572

IUPAC3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid
SMILESCCCCCCCCc1nnc2ccc(C(=O)O)cn12
InChIInChI=1S/C15H21N3O2/c1-2-3-4-5-6-7-8-13-16-17-14-10-9-12(15(19)20)11-18(13)14/h9-11H,2-8H2,1H3,(H,19,20)
InChIKeyWAAVDTIFHUTXLP-UHFFFAOYSA-N
MW275.35 g/mol
LogP3.33
Rot. Bonds8

About 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid

3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (PubChem CID 65427572) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid.

Molecular Properties

Compound Name3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid
PubChem CID65427572
Molecular FormulaC15H21N3O2
Molecular Weight275.35 g/mol
Exact Mass275.16
IUPAC Name3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid
SMILESCCCCCCCCc1nnc2ccc(C(=O)O)cn12
InChIInChI=1S/C15H21N3O2/c1-2-3-4-5-6-7-8-13-16-17-14-10-9-12(15(19)20)11-18(13)14/h9-11H,2-8H2,1H3,(H,19,20)
InChIKeyWAAVDTIFHUTXLP-UHFFFAOYSA-N
XLogP3.33
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.35
LogP ≤ 53.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid?
The IUPAC name of 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid (CID 65427572) is 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid.
What is the SMILES notation for 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid?
The canonical SMILES for 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid is CCCCCCCCc1nnc2ccc(C(=O)O)cn12.
What is the InChIKey of 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid?
The InChIKey is WAAVDTIFHUTXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O2/c1-2-3-4-5-6-7-8-13-16-17-14-10-9-12(15(19)20)11-18(13)14/h9-11H,2-8H2,1H3,(H,19,20).
What are the key properties of 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid?
3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid has a molecular weight of 275.35 g/mol, XLogP of 3.33, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-octyl-[1,2,4]triazolo[4,3-a]pyridine-6-carboxylic acid is sourced from PubChem (CID 65427572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).