About 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine
4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine (PubChem CID 65430083) has the molecular formula C14H6Br2Cl2N2O
and a molecular weight of 448.93 g/mol. Its IUPAC name is 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine.
Molecular Properties
| Compound Name | 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine |
| PubChem CID | 65430083 |
| Molecular Formula | C14H6Br2Cl2N2O |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 445.82 |
| IUPAC Name | 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine |
| SMILES | Clc1nc(-c2cc(Br)c(Br)o2)nc(Cl)c1-c1ccccc1 |
| InChI | InChI=1S/C14H6Br2Cl2N2O/c15-8-6-9(21-11(8)16)14-19-12(17)10(13(18)20-14)7-4-2-1-3-5-7/h1-6H |
| InChIKey | XGHRLJKLUJDHMF-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine?
The IUPAC name of 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine (CID 65430083) is 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine.
What is the SMILES notation for 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine?
The canonical SMILES for 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine is Clc1nc(-c2cc(Br)c(Br)o2)nc(Cl)c1-c1ccccc1.
What is the InChIKey of 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine?
The InChIKey is XGHRLJKLUJDHMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6Br2Cl2N2O/c15-8-6-9(21-11(8)16)14-19-12(17)10(13(18)20-14)7-4-2-1-3-5-7/h1-6H.
What are the key properties of 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine?
4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine has a molecular weight of 448.93 g/mol, XLogP of 6.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-2-(4,5-dibromofuran-2-yl)-5-phenylpyrimidine is sourced from PubChem (CID 65430083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).