C11H15BrN2O2 — CID 65430157
3-(2-amino-4-bromophenoxy)-N-ethylpropanamide (PubChem CID 65430157) has the molecular formula C11H15BrN2O2 and a molecular weight of 287.16 g/mol. Its IUPAC name is 3-(2-amino-4-bromophenoxy)-N-ethylpropanamide.
| Compound Name | 3-(2-amino-4-bromophenoxy)-N-ethylpropanamide |
|---|---|
| PubChem CID | 65430157 |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.16 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-(2-amino-4-bromophenoxy)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCOc1ccc(Br)cc1N |
| InChI | InChI=1S/C11H15BrN2O2/c1-2-14-11(15)5-6-16-10-4-3-8(12)7-9(10)13/h3-4,7H,2,5-6,13H2,1H3,(H,14,15) |
| InChIKey | KHGJTFJFKAFTIA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|