C14H11Br2FN2O2 — CID 65433208
N-(2-amino-4,6-dibromophenyl)-2-fluoro-6-methoxybenzamide (PubChem CID 65433208) has the molecular formula C14H11Br2FN2O2 and a molecular weight of 418.06 g/mol. Its IUPAC name is N-(2-amino-4,6-dibromophenyl)-2-fluoro-6-methoxybenzamide.
| Compound Name | N-(2-amino-4,6-dibromophenyl)-2-fluoro-6-methoxybenzamide |
|---|---|
| PubChem CID | 65433208 |
| Molecular Formula | C14H11Br2FN2O2 |
| Molecular Weight | 418.06 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | N-(2-amino-4,6-dibromophenyl)-2-fluoro-6-methoxybenzamide |
| SMILES | COc1cccc(F)c1C(=O)Nc1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C14H11Br2FN2O2/c1-21-11-4-2-3-9(17)12(11)14(20)19-13-8(16)5-7(15)6-10(13)18/h2-6H,18H2,1H3,(H,19,20) |
| InChIKey | SPKZQGHSEOOPCL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.06 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|