C15H18FNOS — CID 65433257
N-ethyl-1-(2-fluoro-6-methoxyphenyl)-2-thiophen-3-ylethanamine (PubChem CID 65433257) has the molecular formula C15H18FNOS and a molecular weight of 279.38 g/mol. Its IUPAC name is N-ethyl-1-(2-fluoro-6-methoxyphenyl)-2-thiophen-3-ylethanamine.
| Compound Name | N-ethyl-1-(2-fluoro-6-methoxyphenyl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 65433257 |
| Molecular Formula | C15H18FNOS |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | N-ethyl-1-(2-fluoro-6-methoxyphenyl)-2-thiophen-3-ylethanamine |
| SMILES | CCNC(Cc1ccsc1)c1c(F)cccc1OC |
| InChI | InChI=1S/C15H18FNOS/c1-3-17-13(9-11-7-8-19-10-11)15-12(16)5-4-6-14(15)18-2/h4-8,10,13,17H,3,9H2,1-2H3 |
| InChIKey | OBEALGIVZGXHGD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |