About 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline
4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline (PubChem CID 65433520) has the molecular formula C12H13BrFNO
and a molecular weight of 286.14 g/mol. Its IUPAC name is 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline.
Molecular Properties
| Compound Name | 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline |
| PubChem CID | 65433520 |
| Molecular Formula | C12H13BrFNO |
| Molecular Weight | 286.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline |
| SMILES | Fc1cc(NCC2CCC=CO2)ccc1Br |
| InChI | InChI=1S/C12H13BrFNO/c13-11-5-4-9(7-12(11)14)15-8-10-3-1-2-6-16-10/h2,4-7,10,15H,1,3,8H2 |
| InChIKey | ORTZRDDZKARLII-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline?
The IUPAC name of 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline (CID 65433520) is 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline.
What is the SMILES notation for 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline?
The canonical SMILES for 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline is Fc1cc(NCC2CCC=CO2)ccc1Br.
What is the InChIKey of 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline?
The InChIKey is ORTZRDDZKARLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13BrFNO/c13-11-5-4-9(7-12(11)14)15-8-10-3-1-2-6-16-10/h2,4-7,10,15H,1,3,8H2.
What are the key properties of 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline?
4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline has a molecular weight of 286.14 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(3,4-dihydro-2H-pyran-2-ylmethyl)-3-fluoroaniline is sourced from PubChem (CID 65433520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).