C11H17BrN4O — CID 6543362
2-[(2S)-3-(2-bromo-4-methylanilino)-2-hydroxypropyl]guanidine (PubChem CID 6543362) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is 2-[(2S)-3-(2-bromo-4-methylanilino)-2-hydroxypropyl]guanidine.
| Compound Name | 2-[(2S)-3-(2-bromo-4-methylanilino)-2-hydroxypropyl]guanidine |
|---|---|
| PubChem CID | 6543362 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-[(2S)-3-(2-bromo-4-methylanilino)-2-hydroxypropyl]guanidine |
| SMILES | Cc1ccc(NC[C@H](O)CN=C(N)N)c(Br)c1 |
| InChI | InChI=1S/C11H17BrN4O/c1-7-2-3-10(9(12)4-7)15-5-8(17)6-16-11(13)14/h2-4,8,15,17H,5-6H2,1H3,(H4,13,14,16)/t8-/m0/s1 |
| InChIKey | YURPIHSKYCLLHR-QMMMGPOBSA-N |
| XLogP | 0.80 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|