C13H15FN2O2 — CID 65435292
1-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-3-propylurea (PubChem CID 65435292) has the molecular formula C13H15FN2O2 and a molecular weight of 250.27 g/mol. Its IUPAC name is 1-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-3-propylurea.
| Compound Name | 1-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-3-propylurea |
|---|---|
| PubChem CID | 65435292 |
| Molecular Formula | C13H15FN2O2 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-[3-fluoro-4-(3-hydroxyprop-1-ynyl)phenyl]-3-propylurea |
| SMILES | CCCNC(=O)Nc1ccc(C#CCO)c(F)c1 |
| InChI | InChI=1S/C13H15FN2O2/c1-2-7-15-13(18)16-11-6-5-10(4-3-8-17)12(14)9-11/h5-6,9,17H,2,7-8H2,1H3,(H2,15,16,18) |
| InChIKey | KJPYMZXIRDXJEU-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|