C16H16FN3O — CID 65435488
N-[4-(3-aminoprop-1-ynyl)-3-fluorophenyl]-1-ethylpyrrole-2-carboxamide (PubChem CID 65435488) has the molecular formula C16H16FN3O and a molecular weight of 285.32 g/mol. Its IUPAC name is N-[4-(3-aminoprop-1-ynyl)-3-fluorophenyl]-1-ethylpyrrole-2-carboxamide.
| Compound Name | N-[4-(3-aminoprop-1-ynyl)-3-fluorophenyl]-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65435488 |
| Molecular Formula | C16H16FN3O |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-[4-(3-aminoprop-1-ynyl)-3-fluorophenyl]-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cccc1C(=O)Nc1ccc(C#CCN)c(F)c1 |
| InChI | InChI=1S/C16H16FN3O/c1-2-20-10-4-6-15(20)16(21)19-13-8-7-12(5-3-9-18)14(17)11-13/h4,6-8,10-11H,2,9,18H2,1H3,(H,19,21) |
| InChIKey | MNRHBZVFGYTHPJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|