C15H22N2 — CID 6543612
(2R,5R)-1,2,5-trimethyl-N-(2-methylphenyl)piperidin-4-imine (PubChem CID 6543612) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is (2R,5R)-1,2,5-trimethyl-N-(2-methylphenyl)piperidin-4-imine.
| Compound Name | (2R,5R)-1,2,5-trimethyl-N-(2-methylphenyl)piperidin-4-imine |
|---|---|
| PubChem CID | 6543612 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2R,5R)-1,2,5-trimethyl-N-(2-methylphenyl)piperidin-4-imine |
| SMILES | Cc1ccccc1/N=C1\C[C@@H](C)N(C)C[C@H]1C |
| InChI | InChI=1S/C15H22N2/c1-11-7-5-6-8-14(11)16-15-9-13(3)17(4)10-12(15)2/h5-8,12-13H,9-10H2,1-4H3/b16-15+/t12-,13-/m1/s1 |
| InChIKey | QWTISDOHQBTPQV-QVDVFPETSA-N |
| XLogP | 3.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|