C17H19ClN2O — CID 6543613
[(1R,2R,6S,7S)-5-(2-chloroethyl)-3,4-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]-phenylmethanone (PubChem CID 6543613) has the molecular formula C17H19ClN2O and a molecular weight of 302.80 g/mol. Its IUPAC name is [(1R,2R,6S,7S)-5-(2-chloroethyl)-3,4-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]-phenylmethanone.
| Compound Name | [(1R,2R,6S,7S)-5-(2-chloroethyl)-3,4-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 6543613 |
| Molecular Formula | C17H19ClN2O |
| Molecular Weight | 302.80 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | [(1R,2R,6S,7S)-5-(2-chloroethyl)-3,4-diazatricyclo[5.2.1.02,6]dec-4-en-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1N=C(CCCl)[C@H]2[C@H]3CC[C@H](C3)[C@H]21 |
| InChI | InChI=1S/C17H19ClN2O/c18-9-8-14-15-12-6-7-13(10-12)16(15)20(19-14)17(21)11-4-2-1-3-5-11/h1-5,12-13,15-16H,6-10H2/t12-,13+,15+,16+/m0/s1 |
| InChIKey | LEAFVEBNNDDESR-SJXGUFTOSA-N |
| XLogP | 3.54 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.80 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|