C18H25NO2 — CID 6543773
[(4R,4aR,8aS)-1-methyl-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-yl] acetate (PubChem CID 6543773) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is [(4R,4aR,8aS)-1-methyl-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-yl] acetate.
| Compound Name | [(4R,4aR,8aS)-1-methyl-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-yl] acetate |
|---|---|
| PubChem CID | 6543773 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | [(4R,4aR,8aS)-1-methyl-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-4-yl] acetate |
| SMILES | CC(=O)O[C@]1(c2ccccc2)CCN(C)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C18H25NO2/c1-14(20)21-18(15-8-4-3-5-9-15)12-13-19(2)17-11-7-6-10-16(17)18/h3-5,8-9,16-17H,6-7,10-13H2,1-2H3/t16-,17+,18+/m1/s1 |
| InChIKey | TYRBZUUHADCCGQ-SQNIBIBYSA-N |
| XLogP | 3.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |