About 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine
1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine (PubChem CID 65438338) has the molecular formula C15H19ClFNO
and a molecular weight of 283.77 g/mol. Its IUPAC name is 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine |
| PubChem CID | 65438338 |
| Molecular Formula | C15H19ClFNO |
| Molecular Weight | 283.77 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine |
| SMILES | CCNC(c1cc2cc(F)cc(Cl)c2o1)C(C)(C)C |
| InChI | InChI=1S/C15H19ClFNO/c1-5-18-14(15(2,3)4)12-7-9-6-10(17)8-11(16)13(9)19-12/h6-8,14,18H,5H2,1-4H3 |
| InChIKey | ULSIALBVLBWEAG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.77 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
The IUPAC name of 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine (CID 65438338) is 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine is CCNC(c1cc2cc(F)cc(Cl)c2o1)C(C)(C)C.
What is the InChIKey of 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
The InChIKey is ULSIALBVLBWEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19ClFNO/c1-5-18-14(15(2,3)4)12-7-9-6-10(17)8-11(16)13(9)19-12/h6-8,14,18H,5H2,1-4H3.
What are the key properties of 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine has a molecular weight of 283.77 g/mol, XLogP of 4.92, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-chloro-5-fluoro-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 65438338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).