C12H12O3 — CID 6543877
(1'S,2'S,6'R,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one (PubChem CID 6543877) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1'S,2'S,6'R,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one.
| Compound Name | (1'S,2'S,6'R,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one |
|---|---|
| PubChem CID | 6543877 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1'S,2'S,6'R,7'R)-spiro[1,3-dioxolane-2,10'-tricyclo[5.2.1.02,6]deca-4,8-diene]-3'-one |
| SMILES | O=C1C=C[C@@H]2[C@H]1[C@@H]1C=C[C@H]2C12OCCO2 |
| InChI | InChI=1S/C12H12O3/c13-10-4-1-7-8-2-3-9(11(7)10)12(8)14-5-6-15-12/h1-4,7-9,11H,5-6H2/t7-,8+,9-,11-/m0/s1 |
| InChIKey | HQKBGTDYJMQTDV-DKIAZLNASA-N |
| XLogP | 0.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|