C14H23ClN2 — CID 6543895
(3aS,7aS)-5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 6543895) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is (3aS,7aS)-5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | (3aS,7aS)-5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 6543895 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (3aS,7aS)-5-chloro-2-(2-pyrrolidin-1-ylethyl)-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | ClC1=CC[C@@H]2CN(CCN3CCCC3)C[C@H]2C1 |
| InChI | InChI=1S/C14H23ClN2/c15-14-4-3-12-10-17(11-13(12)9-14)8-7-16-5-1-2-6-16/h4,12-13H,1-3,5-11H2/t12-,13-/m1/s1 |
| InChIKey | QLOKZGCVMSPXQI-CHWSQXEVSA-N |
| XLogP | 2.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |