C12H14FNO — CID 65438994
N-[(5-fluoro-1-benzofuran-2-yl)methyl]propan-2-amine (PubChem CID 65438994) has the molecular formula C12H14FNO and a molecular weight of 207.25 g/mol. Its IUPAC name is N-[(5-fluoro-1-benzofuran-2-yl)methyl]propan-2-amine.
| Compound Name | N-[(5-fluoro-1-benzofuran-2-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 65438994 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N-[(5-fluoro-1-benzofuran-2-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc2cc(F)ccc2o1 |
| InChI | InChI=1S/C12H14FNO/c1-8(2)14-7-11-6-9-5-10(13)3-4-12(9)15-11/h3-6,8,14H,7H2,1-2H3 |
| InChIKey | UOMRARSWKZCRNE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |