C17H16N2O2 — CID 6543917
methyl (4R,5R)-4,5-diphenyl-4,5-dihydro-1H-pyrazole-3-carboxylate (PubChem CID 6543917) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is methyl (4R,5R)-4,5-diphenyl-4,5-dihydro-1H-pyrazole-3-carboxylate.
| Compound Name | methyl (4R,5R)-4,5-diphenyl-4,5-dihydro-1H-pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 6543917 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl (4R,5R)-4,5-diphenyl-4,5-dihydro-1H-pyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NN[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c1-21-17(20)16-14(12-8-4-2-5-9-12)15(18-19-16)13-10-6-3-7-11-13/h2-11,14-15,18H,1H3/t14-,15+/m1/s1 |
| InChIKey | NSZUGSLEMJUGAP-CABCVRRESA-N |
| XLogP | 2.64 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |