About 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine
1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine (PubChem CID 65439498) has the molecular formula C17H24ClNO
and a molecular weight of 293.84 g/mol. Its IUPAC name is 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine |
| PubChem CID | 65439498 |
| Molecular Formula | C17H24ClNO |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine |
| SMILES | CCNC(c1cc2c(C)c(Cl)c(C)cc2o1)C(C)(C)C |
| InChI | InChI=1S/C17H24ClNO/c1-7-19-16(17(4,5)6)14-9-12-11(3)15(18)10(2)8-13(12)20-14/h8-9,16,19H,7H2,1-6H3 |
| InChIKey | GGFSXICVSQPAMV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
The IUPAC name of 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine (CID 65439498) is 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine is CCNC(c1cc2c(C)c(Cl)c(C)cc2o1)C(C)(C)C.
What is the InChIKey of 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
The InChIKey is GGFSXICVSQPAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24ClNO/c1-7-19-16(17(4,5)6)14-9-12-11(3)15(18)10(2)8-13(12)20-14/h8-9,16,19H,7H2,1-6H3.
What are the key properties of 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine?
1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine has a molecular weight of 293.84 g/mol, XLogP of 5.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-chloro-4,6-dimethyl-1-benzofuran-2-yl)-N-ethyl-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 65439498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).