C12H13Cl2NO — CID 65439591
1-(4,7-dichloro-1-benzofuran-2-yl)-N-ethylethanamine (PubChem CID 65439591) has the molecular formula C12H13Cl2NO and a molecular weight of 258.15 g/mol. Its IUPAC name is 1-(4,7-dichloro-1-benzofuran-2-yl)-N-ethylethanamine.
| Compound Name | 1-(4,7-dichloro-1-benzofuran-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 65439591 |
| Molecular Formula | C12H13Cl2NO |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(4,7-dichloro-1-benzofuran-2-yl)-N-ethylethanamine |
| SMILES | CCNC(C)c1cc2c(Cl)ccc(Cl)c2o1 |
| InChI | InChI=1S/C12H13Cl2NO/c1-3-15-7(2)11-6-8-9(13)4-5-10(14)12(8)16-11/h4-7,15H,3H2,1-2H3 |
| InChIKey | HKSWFQJOJHOSSR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |