C4H9N5S — CID 65440082
1-[2-(methylamino)ethyl]-2H-tetrazole-5-thione (PubChem CID 65440082) has the molecular formula C4H9N5S and a molecular weight of 159.22 g/mol. Its IUPAC name is 1-[2-(methylamino)ethyl]-2H-tetrazole-5-thione.
| Compound Name | 1-[2-(methylamino)ethyl]-2H-tetrazole-5-thione |
|---|---|
| PubChem CID | 65440082 |
| Molecular Formula | C4H9N5S |
| Molecular Weight | 159.22 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | 1-[2-(methylamino)ethyl]-2H-tetrazole-5-thione |
| SMILES | CNCCn1[nH]nnc1=S |
| InChI | InChI=1S/C4H9N5S/c1-5-2-3-9-4(10)6-7-8-9/h5H,2-3H2,1H3,(H,6,8,10) |
| InChIKey | FZJXCRUZPZOFNK-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.22 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|