(2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid

C6H8F3NO3 — CID 65440456

IUPAC(2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid
SMILESCC[C@@H](NC(=O)C(F)(F)F)C(=O)O
InChIInChI=1S/C6H8F3NO3/c1-2-3(4(11)12)10-5(13)6(7,8)9/h3H,2H2,1H3,(H,10,13)(H,11,12)/t3-/m1/s1
InChIKeyPEHBBHOVUUQKHN-GSVOUGTGSA-N
MW199.13 g/mol
LogP0.53
Rot. Bonds3

About (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid

(2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid (PubChem CID 65440456) has the molecular formula C6H8F3NO3 and a molecular weight of 199.13 g/mol. Its IUPAC name is (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid.

Molecular Properties

Compound Name(2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid
PubChem CID65440456
Molecular FormulaC6H8F3NO3
Molecular Weight199.13 g/mol
Exact Mass199.05
IUPAC Name(2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid
SMILESCC[C@@H](NC(=O)C(F)(F)F)C(=O)O
InChIInChI=1S/C6H8F3NO3/c1-2-3(4(11)12)10-5(13)6(7,8)9/h3H,2H2,1H3,(H,10,13)(H,11,12)/t3-/m1/s1
InChIKeyPEHBBHOVUUQKHN-GSVOUGTGSA-N
XLogP0.53
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.13
LogP ≤ 50.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid?
The IUPAC name of (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid (CID 65440456) is (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid.
What is the SMILES notation for (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid?
The canonical SMILES for (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid is CC[C@@H](NC(=O)C(F)(F)F)C(=O)O.
What is the InChIKey of (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid?
The InChIKey is PEHBBHOVUUQKHN-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H8F3NO3/c1-2-3(4(11)12)10-5(13)6(7,8)9/h3H,2H2,1H3,(H,10,13)(H,11,12)/t3-/m1/s1.
What are the key properties of (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid?
(2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid has a molecular weight of 199.13 g/mol, XLogP of 0.53, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid is sourced from PubChem (CID 65440456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).