C5H10N4S — CID 65440648
5-N-propyl-1,2,4-thiadiazole-3,5-diamine (PubChem CID 65440648) has the molecular formula C5H10N4S and a molecular weight of 158.23 g/mol. Its IUPAC name is 5-N-propyl-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-propyl-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 65440648 |
| Molecular Formula | C5H10N4S |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 5-N-propyl-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCCNc1nc(N)ns1 |
| InChI | InChI=1S/C5H10N4S/c1-2-3-7-5-8-4(6)9-10-5/h2-3H2,1H3,(H3,6,7,8,9) |
| InChIKey | KUFJNLDVQZICPK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |