C13H16ClNO — CID 65440764
1-(7-chloro-1-benzofuran-2-yl)-N-methylbutan-1-amine (PubChem CID 65440764) has the molecular formula C13H16ClNO and a molecular weight of 237.73 g/mol. Its IUPAC name is 1-(7-chloro-1-benzofuran-2-yl)-N-methylbutan-1-amine.
| Compound Name | 1-(7-chloro-1-benzofuran-2-yl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 65440764 |
| Molecular Formula | C13H16ClNO |
| Molecular Weight | 237.73 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-(7-chloro-1-benzofuran-2-yl)-N-methylbutan-1-amine |
| SMILES | CCCC(NC)c1cc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C13H16ClNO/c1-3-5-11(15-2)12-8-9-6-4-7-10(14)13(9)16-12/h4,6-8,11,15H,3,5H2,1-2H3 |
| InChIKey | POQOWVLZSTWVMB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.73 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |