C11H19NO5S2 — CID 65441725
2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65441725) has the molecular formula C11H19NO5S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65441725 |
| Molecular Formula | C11H19NO5S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[1-[2-(3-amino-3-oxopropyl)sulfonylethylsulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | NC(=O)CCS(=O)(=O)CCSCC1(CC(=O)O)CC1 |
| InChI | InChI=1S/C11H19NO5S2/c12-9(13)1-5-19(16,17)6-4-18-8-11(2-3-11)7-10(14)15/h1-8H2,(H2,12,13)(H,14,15) |
| InChIKey | JLIUCVOUHKYMDJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|