About methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate
methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate (PubChem CID 65442221) has the molecular formula C12H17N3O4
and a molecular weight of 267.29 g/mol. Its IUPAC name is methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate.
Molecular Properties
| Compound Name | methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate |
| PubChem CID | 65442221 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate |
| SMILES | COC(=O)C(Cn1c(C)cc(C)nc1=O)NC(C)=O |
| InChI | InChI=1S/C12H17N3O4/c1-7-5-8(2)15(12(18)13-7)6-10(11(17)19-4)14-9(3)16/h5,10H,6H2,1-4H3,(H,14,16) |
| InChIKey | RIUYNDILFFTPNL-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The IUPAC name of methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate (CID 65442221) is methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate.
What is the SMILES notation for methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The canonical SMILES for methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate is COC(=O)C(Cn1c(C)cc(C)nc1=O)NC(C)=O.
What is the InChIKey of methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
The InChIKey is RIUYNDILFFTPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O4/c1-7-5-8(2)15(12(18)13-7)6-10(11(17)19-4)14-9(3)16/h5,10H,6H2,1-4H3,(H,14,16).
What are the key properties of methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate?
methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate has a molecular weight of 267.29 g/mol, XLogP of -0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3-(4,6-dimethyl-2-oxopyrimidin-1-yl)propanoate is sourced from PubChem (CID 65442221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).