C16H24O2 — CID 65442461
6-(2,3-dihydro-1-benzofuran-5-yl)-4,4-dimethylhexan-2-ol (PubChem CID 65442461) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 6-(2,3-dihydro-1-benzofuran-5-yl)-4,4-dimethylhexan-2-ol.
| Compound Name | 6-(2,3-dihydro-1-benzofuran-5-yl)-4,4-dimethylhexan-2-ol |
|---|---|
| PubChem CID | 65442461 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 6-(2,3-dihydro-1-benzofuran-5-yl)-4,4-dimethylhexan-2-ol |
| SMILES | CC(O)CC(C)(C)CCc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C16H24O2/c1-12(17)11-16(2,3)8-6-13-4-5-15-14(10-13)7-9-18-15/h4-5,10,12,17H,6-9,11H2,1-3H3 |
| InChIKey | OUBPOEXHHLXLBG-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |