C16H29NO3S — CID 65442695
2-[1-[[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65442695) has the molecular formula C16H29NO3S and a molecular weight of 315.48 g/mol. Its IUPAC name is 2-[1-[[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65442695 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 2-[1-[[2-(6-methylheptan-2-ylamino)-2-oxoethyl]sulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | CC(C)CCCC(C)NC(=O)CSCC1(CC(=O)O)CC1 |
| InChI | InChI=1S/C16H29NO3S/c1-12(2)5-4-6-13(3)17-14(18)10-21-11-16(7-8-16)9-15(19)20/h12-13H,4-11H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | BGIPKPSCPLHBHK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |