C17H19NOS — CID 6544293
(3aS,4S,9bS)-8-ethyl-4-thiophen-2-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline (PubChem CID 6544293) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is (3aS,4S,9bS)-8-ethyl-4-thiophen-2-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline.
| Compound Name | (3aS,4S,9bS)-8-ethyl-4-thiophen-2-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
|---|---|
| PubChem CID | 6544293 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (3aS,4S,9bS)-8-ethyl-4-thiophen-2-yl-2,3,3a,4,5,9b-hexahydrofuro[3,2-c]quinoline |
| SMILES | CCc1ccc2c(c1)[C@H]1OCC[C@H]1[C@@H](c1cccs1)N2 |
| InChI | InChI=1S/C17H19NOS/c1-2-11-5-6-14-13(10-11)17-12(7-8-19-17)16(18-14)15-4-3-9-20-15/h3-6,9-10,12,16-18H,2,7-8H2,1H3/t12-,16-,17-/m0/s1 |
| InChIKey | QYWZUJQAUNKMIP-ZLIFDBKOSA-N |
| XLogP | 4.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |