About 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid
2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid (PubChem CID 65443409) has the molecular formula C7H10N2O3S
and a molecular weight of 202.24 g/mol. Its IUPAC name is 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid |
| PubChem CID | 65443409 |
| Molecular Formula | C7H10N2O3S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid |
| SMILES | Cc1csc(=O)n1CC(N)C(=O)O |
| InChI | InChI=1S/C7H10N2O3S/c1-4-3-13-7(12)9(4)2-5(8)6(10)11/h3,5H,2,8H2,1H3,(H,10,11) |
| InChIKey | KMHMUWRULKGNDH-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 85.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
The IUPAC name of 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid (CID 65443409) is 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid.
What is the SMILES notation for 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
The canonical SMILES for 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid is Cc1csc(=O)n1CC(N)C(=O)O.
What is the InChIKey of 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
The InChIKey is KMHMUWRULKGNDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3S/c1-4-3-13-7(12)9(4)2-5(8)6(10)11/h3,5H,2,8H2,1H3,(H,10,11).
What are the key properties of 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid?
2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid has a molecular weight of 202.24 g/mol, XLogP of -0.37, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(4-methyl-2-oxo-1,3-thiazol-3-yl)propanoic acid is sourced from PubChem (CID 65443409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).