C10H17N3O3 — CID 65444021
methyl 2-acetamido-3-[2-cyanoethyl(methyl)amino]propanoate (PubChem CID 65444021) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is methyl 2-acetamido-3-[2-cyanoethyl(methyl)amino]propanoate.
| Compound Name | methyl 2-acetamido-3-[2-cyanoethyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 65444021 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | methyl 2-acetamido-3-[2-cyanoethyl(methyl)amino]propanoate |
| SMILES | COC(=O)C(CN(C)CCC#N)NC(C)=O |
| InChI | InChI=1S/C10H17N3O3/c1-8(14)12-9(10(15)16-3)7-13(2)6-4-5-11/h9H,4,6-7H2,1-3H3,(H,12,14) |
| InChIKey | UHJMZEDNVKTQNL-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |