About (2S)-2-phenylbutanamide
(2S)-2-phenylbutanamide (PubChem CID 6544471) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is (2S)-2-phenylbutanamide.
Molecular Properties
| Compound Name | (2S)-2-phenylbutanamide |
| PubChem CID | 6544471 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | (2S)-2-phenylbutanamide |
| SMILES | CC[C@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C10H13NO/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H2,11,12)/t9-/m0/s1 |
| InChIKey | UNFGQCCHVMMMRF-VIFPVBQESA-N |
| XLogP | 1.67 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-phenylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-phenylbutanamide?
The IUPAC name of (2S)-2-phenylbutanamide (CID 6544471) is (2S)-2-phenylbutanamide.
What is the SMILES notation for (2S)-2-phenylbutanamide?
The canonical SMILES for (2S)-2-phenylbutanamide is CC[C@H](C(N)=O)c1ccccc1.
What is the InChIKey of (2S)-2-phenylbutanamide?
The InChIKey is UNFGQCCHVMMMRF-VIFPVBQESA-N. The full InChI is InChI=1S/C10H13NO/c1-2-9(10(11)12)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H2,11,12)/t9-/m0/s1.
What are the key properties of (2S)-2-phenylbutanamide?
(2S)-2-phenylbutanamide has a molecular weight of 163.22 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-phenylbutanamide is sourced from PubChem (CID 6544471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).