About cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid
cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid (PubChem CID 6544483) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid |
| PubChem CID | 6544483 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid |
| SMILES | O=C(O)[C@H]1CC[C@H]1C(=O)O |
| InChI | InChI=1S/C6H8O4/c7-5(8)3-1-2-4(3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)/t3-,4+ |
| InChIKey | SUSAGCZZQKACKE-ZXZARUISSA-N |
| XLogP | 0.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid?
The IUPAC name of cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid (CID 6544483) is cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid.
What is the SMILES notation for cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid?
The canonical SMILES for cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid is O=C(O)[C@H]1CC[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid?
The InChIKey is SUSAGCZZQKACKE-ZXZARUISSA-N. The full InChI is InChI=1S/C6H8O4/c7-5(8)3-1-2-4(3)6(9)10/h3-4H,1-2H2,(H,7,8)(H,9,10)/t3-,4+.
What are the key properties of cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid?
cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid has a molecular weight of 144.13 g/mol, XLogP of 0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-cyclobutane-1,2-dicarboxylic acid is sourced from PubChem (CID 6544483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).