C15H15F2NOS — CID 65444980
3,5-difluoro-4-[2-(4-methoxyphenyl)ethylsulfanyl]aniline (PubChem CID 65444980) has the molecular formula C15H15F2NOS and a molecular weight of 295.35 g/mol. Its IUPAC name is 3,5-difluoro-4-[2-(4-methoxyphenyl)ethylsulfanyl]aniline.
| Compound Name | 3,5-difluoro-4-[2-(4-methoxyphenyl)ethylsulfanyl]aniline |
|---|---|
| PubChem CID | 65444980 |
| Molecular Formula | C15H15F2NOS |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 3,5-difluoro-4-[2-(4-methoxyphenyl)ethylsulfanyl]aniline |
| SMILES | COc1ccc(CCSc2c(F)cc(N)cc2F)cc1 |
| InChI | InChI=1S/C15H15F2NOS/c1-19-12-4-2-10(3-5-12)6-7-20-15-13(16)8-11(18)9-14(15)17/h2-5,8-9H,6-7,18H2,1H3 |
| InChIKey | GZQIAZYQOCDBIC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|