About 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol
1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol (PubChem CID 65449828) has the molecular formula C9H17F3N2O2
and a molecular weight of 242.24 g/mol. Its IUPAC name is 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol.
Molecular Properties
| Compound Name | 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol |
| PubChem CID | 65449828 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol |
| SMILES | OC(COCC(F)(F)F)CN1CCNCC1 |
| InChI | InChI=1S/C9H17F3N2O2/c10-9(11,12)7-16-6-8(15)5-14-3-1-13-2-4-14/h8,13,15H,1-7H2 |
| InChIKey | ICWBFBFMVNKMOM-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol?
The IUPAC name of 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol (CID 65449828) is 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol.
What is the SMILES notation for 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol?
The canonical SMILES for 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol is OC(COCC(F)(F)F)CN1CCNCC1.
What is the InChIKey of 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol?
The InChIKey is ICWBFBFMVNKMOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F3N2O2/c10-9(11,12)7-16-6-8(15)5-14-3-1-13-2-4-14/h8,13,15H,1-7H2.
What are the key properties of 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol?
1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol has a molecular weight of 242.24 g/mol, XLogP of -0.17, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperazin-1-yl-3-(2,2,2-trifluoroethoxy)propan-2-ol is sourced from PubChem (CID 65449828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).