C17H16N2OS — CID 65450538
N-(1-benzothiophen-5-yl)-4-(ethylamino)benzamide (PubChem CID 65450538) has the molecular formula C17H16N2OS and a molecular weight of 296.40 g/mol. Its IUPAC name is N-(1-benzothiophen-5-yl)-4-(ethylamino)benzamide.
| Compound Name | N-(1-benzothiophen-5-yl)-4-(ethylamino)benzamide |
|---|---|
| PubChem CID | 65450538 |
| Molecular Formula | C17H16N2OS |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | N-(1-benzothiophen-5-yl)-4-(ethylamino)benzamide |
| SMILES | CCNc1ccc(C(=O)Nc2ccc3sccc3c2)cc1 |
| InChI | InChI=1S/C17H16N2OS/c1-2-18-14-5-3-12(4-6-14)17(20)19-15-7-8-16-13(11-15)9-10-21-16/h3-11,18H,2H2,1H3,(H,19,20) |
| InChIKey | MHPRNXXQJXADFZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |