C7H5Cl2N5S — CID 65450948
2-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)guanidine (PubChem CID 65450948) has the molecular formula C7H5Cl2N5S and a molecular weight of 262.12 g/mol. Its IUPAC name is 2-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)guanidine.
| Compound Name | 2-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)guanidine |
|---|---|
| PubChem CID | 65450948 |
| Molecular Formula | C7H5Cl2N5S |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)guanidine |
| SMILES | NC(N)=Nc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C7H5Cl2N5S/c8-2-1-3(9)5-6(14-15-13-5)4(2)12-7(10)11/h1H,(H4,10,11,12) |
| InChIKey | YZZVXTLZVLYNFM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|