C8H7Cl2N5S — CID 65450949
1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylguanidine (PubChem CID 65450949) has the molecular formula C8H7Cl2N5S and a molecular weight of 276.15 g/mol. Its IUPAC name is 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylguanidine.
| Compound Name | 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 65450949 |
| Molecular Formula | C8H7Cl2N5S |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C8H7Cl2N5S/c1-12-8(11)13-5-3(9)2-4(10)6-7(5)15-16-14-6/h2H,1H3,(H3,11,12,13) |
| InChIKey | OFRPDYNXGJPNOO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|