C11H13Cl2N5S — CID 65451356
1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-(2-methylpropyl)guanidine (PubChem CID 65451356) has the molecular formula C11H13Cl2N5S and a molecular weight of 318.23 g/mol. Its IUPAC name is 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-(2-methylpropyl)guanidine.
| Compound Name | 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 65451356 |
| Molecular Formula | C11H13Cl2N5S |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 1-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(\N)Nc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C11H13Cl2N5S/c1-5(2)4-15-11(14)16-8-6(12)3-7(13)9-10(8)18-19-17-9/h3,5H,4H2,1-2H3,(H3,14,15,16) |
| InChIKey | XXBAUFQLYPDATN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|