C16H23NO2 — CID 6545147
1-[(1R,6S,8S)-spiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,1'-cyclohexane]-3-yl]ethanone (PubChem CID 6545147) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-[(1R,6S,8S)-spiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,1'-cyclohexane]-3-yl]ethanone.
| Compound Name | 1-[(1R,6S,8S)-spiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,1'-cyclohexane]-3-yl]ethanone |
|---|---|
| PubChem CID | 6545147 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[(1R,6S,8S)-spiro[11-oxa-3-azatricyclo[6.2.1.01,6]undec-9-ene-4,1'-cyclohexane]-3-yl]ethanone |
| SMILES | CC(=O)N1C[C@]23C=C[C@H](C[C@@H]2CC12CCCCC2)O3 |
| InChI | InChI=1S/C16H23NO2/c1-12(18)17-11-16-8-5-14(19-16)9-13(16)10-15(17)6-3-2-4-7-15/h5,8,13-14H,2-4,6-7,9-11H2,1H3/t13-,14-,16-/m1/s1 |
| InChIKey | JNJDVHLGVVODSS-IIAWOOMASA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|