About 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine
2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine (PubChem CID 65451561) has the molecular formula C7H6ClN5S
and a molecular weight of 227.68 g/mol. Its IUPAC name is 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine.
Molecular Properties
| Compound Name | 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine |
| PubChem CID | 65451561 |
| Molecular Formula | C7H6ClN5S |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 227.00 |
| IUPAC Name | 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine |
| SMILES | NC(N)=Nc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C7H6ClN5S/c8-3-1-2-4-6(13-14-12-4)5(3)11-7(9)10/h1-2H,(H4,9,10,11) |
| InChIKey | SAPSJZRZNCXXTI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
The IUPAC name of 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine (CID 65451561) is 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine.
What is the SMILES notation for 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
The canonical SMILES for 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine is NC(N)=Nc1c(Cl)ccc2nsnc12.
What is the InChIKey of 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
The InChIKey is SAPSJZRZNCXXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClN5S/c8-3-1-2-4-6(13-14-12-4)5(3)11-7(9)10/h1-2H,(H4,9,10,11).
What are the key properties of 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine?
2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine has a molecular weight of 227.68 g/mol, XLogP of 1.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-2,1,3-benzothiadiazol-4-yl)guanidine is sourced from PubChem (CID 65451561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).