C13H15N5 — CID 654516
N,N-diethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine (PubChem CID 654516) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is N,N-diethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine.
| Compound Name | N,N-diethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 654516 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | N,N-diethyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-amine |
| SMILES | CCN(CC)c1nc2ccccc2n2cnnc12 |
| InChI | InChI=1S/C13H15N5/c1-3-17(4-2)12-13-16-14-9-18(13)11-8-6-5-7-10(11)15-12/h5-9H,3-4H2,1-2H3 |
| InChIKey | KTRZFDUOUIVFLG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |